C19H26BrN3O3 — CID 4724516
1-[2-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]ethylamino]propan-2-ol (PubChem CID 4724516) has the molecular formula C19H26BrN3O3 and a molecular weight of 424.34 g/mol. Its IUPAC name is 1-[2-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]ethylamino]propan-2-ol.
| Compound Name | 1-[2-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 4724516 |
| Molecular Formula | C19H26BrN3O3 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 1-[2-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]ethylamino]propan-2-ol |
| SMILES | COc1cc(CNCCNCC(C)O)cc(Br)c1OCc1cccnc1 |
| InChI | InChI=1S/C19H26BrN3O3/c1-14(24)10-22-6-7-23-12-16-8-17(20)19(18(9-16)25-2)26-13-15-4-3-5-21-11-15/h3-5,8-9,11,14,22-24H,6-7,10,12-13H2,1-2H3 |
| InChIKey | PGZZRBHUDJCYFQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|