C22H23BrCl2N4O4 — CID 17333022
N-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine;hydrochloride (PubChem CID 17333022) has the molecular formula C22H23BrCl2N4O4 and a molecular weight of 558.26 g/mol. Its IUPAC name is N-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | N-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 17333022 |
| Molecular Formula | C22H23BrCl2N4O4 |
| Molecular Weight | 558.26 g/mol |
| Exact Mass | 556.03 |
| IUPAC Name | N-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine;hydrochloride |
| SMILES | COc1cc(CNCCNc2ccc([N+](=O)[O-])cc2Cl)cc(Br)c1OCc1cccnc1.Cl |
| InChI | InChI=1S/C22H22BrClN4O4.ClH/c1-31-21-10-16(9-18(23)22(21)32-14-15-3-2-6-25-12-15)13-26-7-8-27-20-5-4-17(28(29)30)11-19(20)24;/h2-6,9-12,26-27H,7-8,13-14H2,1H3;1H |
| InChIKey | ARZKOGMVMHOTTC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.26 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|