C18H21Cl2N3O4 — CID 4722308
N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine (PubChem CID 4722308) has the molecular formula C18H21Cl2N3O4 and a molecular weight of 414.29 g/mol. Its IUPAC name is N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 4722308 |
| Molecular Formula | C18H21Cl2N3O4 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine |
| SMILES | CCOc1c(Cl)cc(CNCCNc2ccc([N+](=O)[O-])cc2Cl)cc1OC |
| InChI | InChI=1S/C18H21Cl2N3O4/c1-3-27-18-15(20)8-12(9-17(18)26-2)11-21-6-7-22-16-5-4-13(23(24)25)10-14(16)19/h4-5,8-10,21-22H,3,6-7,11H2,1-2H3 |
| InChIKey | OKLYLGJDBMGGNU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|