C16H17ClN2O4 — CID 78885729
2-chloro-N-[(3-ethoxy-4-methoxyphenyl)methyl]-4-nitroaniline (PubChem CID 78885729) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is 2-chloro-N-[(3-ethoxy-4-methoxyphenyl)methyl]-4-nitroaniline.
| Compound Name | 2-chloro-N-[(3-ethoxy-4-methoxyphenyl)methyl]-4-nitroaniline |
|---|---|
| PubChem CID | 78885729 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-chloro-N-[(3-ethoxy-4-methoxyphenyl)methyl]-4-nitroaniline |
| SMILES | CCOc1cc(CNc2ccc([N+](=O)[O-])cc2Cl)ccc1OC |
| InChI | InChI=1S/C16H17ClN2O4/c1-3-23-16-8-11(4-7-15(16)22-2)10-18-14-6-5-12(19(20)21)9-13(14)17/h4-9,18H,3,10H2,1-2H3 |
| InChIKey | RJQUDWKEAGOEDN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|