C17H19Cl2N3O3 — CID 4717734
N-[(5-chloro-2-ethoxyphenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine (PubChem CID 4717734) has the molecular formula C17H19Cl2N3O3 and a molecular weight of 384.26 g/mol. Its IUPAC name is N-[(5-chloro-2-ethoxyphenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N-[(5-chloro-2-ethoxyphenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 4717734 |
| Molecular Formula | C17H19Cl2N3O3 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-[(5-chloro-2-ethoxyphenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine |
| SMILES | CCOc1ccc(Cl)cc1CNCCNc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H19Cl2N3O3/c1-2-25-17-6-3-13(18)9-12(17)11-20-7-8-21-16-5-4-14(22(23)24)10-15(16)19/h3-6,9-10,20-21H,2,7-8,11H2,1H3 |
| InChIKey | ARHNNWCKSFODMM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|