C22H21Cl3FN3O3 — CID 17292449
N-[[5-chloro-2-[(2-fluorophenyl)methoxy]phenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine;hydrochloride (PubChem CID 17292449) has the molecular formula C22H21Cl3FN3O3 and a molecular weight of 500.79 g/mol. Its IUPAC name is N-[[5-chloro-2-[(2-fluorophenyl)methoxy]phenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | N-[[5-chloro-2-[(2-fluorophenyl)methoxy]phenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 17292449 |
| Molecular Formula | C22H21Cl3FN3O3 |
| Molecular Weight | 500.79 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | N-[[5-chloro-2-[(2-fluorophenyl)methoxy]phenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(NCCNCc2cc(Cl)ccc2OCc2ccccc2F)c(Cl)c1 |
| InChI | InChI=1S/C22H20Cl2FN3O3.ClH/c23-17-5-8-22(31-14-15-3-1-2-4-20(15)25)16(11-17)13-26-9-10-27-21-7-6-18(28(29)30)12-19(21)24;/h1-8,11-12,26-27H,9-10,13-14H2;1H |
| InChIKey | PPJBFIDVMVKZNA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.79 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|