C17H18BrClN4O4 — CID 17053799
2-[4-bromo-2-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]phenoxy]acetamide (PubChem CID 17053799) has the molecular formula C17H18BrClN4O4 and a molecular weight of 457.71 g/mol. Its IUPAC name is 2-[4-bromo-2-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]phenoxy]acetamide.
| Compound Name | 2-[4-bromo-2-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 17053799 |
| Molecular Formula | C17H18BrClN4O4 |
| Molecular Weight | 457.71 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 2-[4-bromo-2-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(Br)cc1CNCCNc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H18BrClN4O4/c18-12-1-4-16(27-10-17(20)24)11(7-12)9-21-5-6-22-15-3-2-13(23(25)26)8-14(15)19/h1-4,7-8,21-22H,5-6,9-10H2,(H2,20,24) |
| InChIKey | OEMKZZOYUAIGJB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.71 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|