C23H24Cl3N3O4 — CID 17292437
N-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine;hydrochloride (PubChem CID 17292437) has the molecular formula C23H24Cl3N3O4 and a molecular weight of 512.82 g/mol. Its IUPAC name is N-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | N-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 17292437 |
| Molecular Formula | C23H24Cl3N3O4 |
| Molecular Weight | 512.82 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | N-[(3-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine;hydrochloride |
| SMILES | COc1cc(CNCCNc2ccc([N+](=O)[O-])cc2Cl)cc(Cl)c1OCc1ccccc1.Cl |
| InChI | InChI=1S/C23H23Cl2N3O4.ClH/c1-31-22-12-17(11-20(25)23(22)32-15-16-5-3-2-4-6-16)14-26-9-10-27-21-8-7-18(28(29)30)13-19(21)24;/h2-8,11-13,26-27H,9-10,14-15H2,1H3;1H |
| InChIKey | MFWDEXSRRIKQQW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.82 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|