C13H17Br2NO3 — CID 107742173
ethyl 2-[2,6-dibromo-4-(ethylaminomethyl)phenoxy]acetate (PubChem CID 107742173) has the molecular formula C13H17Br2NO3 and a molecular weight of 395.09 g/mol. Its IUPAC name is ethyl 2-[2,6-dibromo-4-(ethylaminomethyl)phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-dibromo-4-(ethylaminomethyl)phenoxy]acetate |
|---|---|
| PubChem CID | 107742173 |
| Molecular Formula | C13H17Br2NO3 |
| Molecular Weight | 395.09 g/mol |
| Exact Mass | 392.96 |
| IUPAC Name | ethyl 2-[2,6-dibromo-4-(ethylaminomethyl)phenoxy]acetate |
| SMILES | CCNCc1cc(Br)c(OCC(=O)OCC)c(Br)c1 |
| InChI | InChI=1S/C13H17Br2NO3/c1-3-16-7-9-5-10(14)13(11(15)6-9)19-8-12(17)18-4-2/h5-6,16H,3-4,7-8H2,1-2H3 |
| InChIKey | VGKQXUFTUVOELO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.09 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |