C12H15Br2N3O3 — CID 107742179
N-carbamoyl-2-[2,6-dibromo-4-(ethylaminomethyl)phenoxy]acetamide (PubChem CID 107742179) has the molecular formula C12H15Br2N3O3 and a molecular weight of 409.08 g/mol. Its IUPAC name is N-carbamoyl-2-[2,6-dibromo-4-(ethylaminomethyl)phenoxy]acetamide.
| Compound Name | N-carbamoyl-2-[2,6-dibromo-4-(ethylaminomethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 107742179 |
| Molecular Formula | C12H15Br2N3O3 |
| Molecular Weight | 409.08 g/mol |
| Exact Mass | 406.95 |
| IUPAC Name | N-carbamoyl-2-[2,6-dibromo-4-(ethylaminomethyl)phenoxy]acetamide |
| SMILES | CCNCc1cc(Br)c(OCC(=O)NC(N)=O)c(Br)c1 |
| InChI | InChI=1S/C12H15Br2N3O3/c1-2-16-5-7-3-8(13)11(9(14)4-7)20-6-10(18)17-12(15)19/h3-4,16H,2,5-6H2,1H3,(H3,15,17,18,19) |
| InChIKey | LFIILOZIYYOGRU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.08 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |