C13H18Br2N2O2 — CID 107742264
3-[2,6-dibromo-4-(ethylaminomethyl)phenoxy]-2-methylpropanamide (PubChem CID 107742264) has the molecular formula C13H18Br2N2O2 and a molecular weight of 394.11 g/mol. Its IUPAC name is 3-[2,6-dibromo-4-(ethylaminomethyl)phenoxy]-2-methylpropanamide.
| Compound Name | 3-[2,6-dibromo-4-(ethylaminomethyl)phenoxy]-2-methylpropanamide |
|---|---|
| PubChem CID | 107742264 |
| Molecular Formula | C13H18Br2N2O2 |
| Molecular Weight | 394.11 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | 3-[2,6-dibromo-4-(ethylaminomethyl)phenoxy]-2-methylpropanamide |
| SMILES | CCNCc1cc(Br)c(OCC(C)C(N)=O)c(Br)c1 |
| InChI | InChI=1S/C13H18Br2N2O2/c1-3-17-6-9-4-10(14)12(11(15)5-9)19-7-8(2)13(16)18/h4-5,8,17H,3,6-7H2,1-2H3,(H2,16,18) |
| InChIKey | BCIXUWSKMWKGOW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.11 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |