C13H18BrN3O3 — CID 63044671
2-[2-bromo-4-(propylaminomethyl)phenoxy]-N-carbamoylacetamide (PubChem CID 63044671) has the molecular formula C13H18BrN3O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is 2-[2-bromo-4-(propylaminomethyl)phenoxy]-N-carbamoylacetamide.
| Compound Name | 2-[2-bromo-4-(propylaminomethyl)phenoxy]-N-carbamoylacetamide |
|---|---|
| PubChem CID | 63044671 |
| Molecular Formula | C13H18BrN3O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 2-[2-bromo-4-(propylaminomethyl)phenoxy]-N-carbamoylacetamide |
| SMILES | CCCNCc1ccc(OCC(=O)NC(N)=O)c(Br)c1 |
| InChI | InChI=1S/C13H18BrN3O3/c1-2-5-16-7-9-3-4-11(10(14)6-9)20-8-12(18)17-13(15)19/h3-4,6,16H,2,5,7-8H2,1H3,(H3,15,17,18,19) |
| InChIKey | HMOKCTJBNWZFMI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|