C12H13Br2NO4 — CID 8914727
ethyl N-[2-(2,6-dibromo-4-methylphenoxy)acetyl]carbamate (PubChem CID 8914727) has the molecular formula C12H13Br2NO4 and a molecular weight of 395.05 g/mol. Its IUPAC name is ethyl N-[2-(2,6-dibromo-4-methylphenoxy)acetyl]carbamate.
| Compound Name | ethyl N-[2-(2,6-dibromo-4-methylphenoxy)acetyl]carbamate |
|---|---|
| PubChem CID | 8914727 |
| Molecular Formula | C12H13Br2NO4 |
| Molecular Weight | 395.05 g/mol |
| Exact Mass | 392.92 |
| IUPAC Name | ethyl N-[2-(2,6-dibromo-4-methylphenoxy)acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)COc1c(Br)cc(C)cc1Br |
| InChI | InChI=1S/C12H13Br2NO4/c1-3-18-12(17)15-10(16)6-19-11-8(13)4-7(2)5-9(11)14/h4-5H,3,6H2,1-2H3,(H,15,16,17) |
| InChIKey | YVKBZDZPHPXUEJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.05 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |