C11H10Br2O5 — CID 103694206
3,5-dibromo-4-(2-ethoxy-2-oxoethoxy)benzoic acid (PubChem CID 103694206) has the molecular formula C11H10Br2O5 and a molecular weight of 382.00 g/mol. Its IUPAC name is 3,5-dibromo-4-(2-ethoxy-2-oxoethoxy)benzoic acid.
| Compound Name | 3,5-dibromo-4-(2-ethoxy-2-oxoethoxy)benzoic acid |
|---|---|
| PubChem CID | 103694206 |
| Molecular Formula | C11H10Br2O5 |
| Molecular Weight | 382.00 g/mol |
| Exact Mass | 379.89 |
| IUPAC Name | 3,5-dibromo-4-(2-ethoxy-2-oxoethoxy)benzoic acid |
| SMILES | CCOC(=O)COc1c(Br)cc(C(=O)O)cc1Br |
| InChI | InChI=1S/C11H10Br2O5/c1-2-17-9(14)5-18-10-7(12)3-6(11(15)16)4-8(10)13/h3-4H,2,5H2,1H3,(H,15,16) |
| InChIKey | ITRPRMSTFLNOPK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.00 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |