C10H10Br2O4 — CID 107738656
3,5-dibromo-4-(ethoxymethoxy)benzoic acid (PubChem CID 107738656) has the molecular formula C10H10Br2O4 and a molecular weight of 353.99 g/mol. Its IUPAC name is 3,5-dibromo-4-(ethoxymethoxy)benzoic acid.
| Compound Name | 3,5-dibromo-4-(ethoxymethoxy)benzoic acid |
|---|---|
| PubChem CID | 107738656 |
| Molecular Formula | C10H10Br2O4 |
| Molecular Weight | 353.99 g/mol |
| Exact Mass | 351.89 |
| IUPAC Name | 3,5-dibromo-4-(ethoxymethoxy)benzoic acid |
| SMILES | CCOCOc1c(Br)cc(C(=O)O)cc1Br |
| InChI | InChI=1S/C10H10Br2O4/c1-2-15-5-16-9-7(11)3-6(10(13)14)4-8(9)12/h3-4H,2,5H2,1H3,(H,13,14) |
| InChIKey | HDCLRBISBORJBA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.99 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|