C10H11Br3O2 — CID 107745815
1,3-dibromo-5-(bromomethyl)-2-(ethoxymethoxy)benzene (PubChem CID 107745815) has the molecular formula C10H11Br3O2 and a molecular weight of 402.91 g/mol. Its IUPAC name is 1,3-dibromo-5-(bromomethyl)-2-(ethoxymethoxy)benzene.
| Compound Name | 1,3-dibromo-5-(bromomethyl)-2-(ethoxymethoxy)benzene |
|---|---|
| PubChem CID | 107745815 |
| Molecular Formula | C10H11Br3O2 |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 399.83 |
| IUPAC Name | 1,3-dibromo-5-(bromomethyl)-2-(ethoxymethoxy)benzene |
| SMILES | CCOCOc1c(Br)cc(CBr)cc1Br |
| InChI | InChI=1S/C10H11Br3O2/c1-2-14-6-15-10-8(12)3-7(5-11)4-9(10)13/h3-4H,2,5-6H2,1H3 |
| InChIKey | IXKSTOADZJEEIJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|