C12H15Br2NO3 — CID 107739477
ethyl 2-[4-(2-aminoethyl)-2,6-dibromophenoxy]acetate (PubChem CID 107739477) has the molecular formula C12H15Br2NO3 and a molecular weight of 381.06 g/mol. Its IUPAC name is ethyl 2-[4-(2-aminoethyl)-2,6-dibromophenoxy]acetate.
| Compound Name | ethyl 2-[4-(2-aminoethyl)-2,6-dibromophenoxy]acetate |
|---|---|
| PubChem CID | 107739477 |
| Molecular Formula | C12H15Br2NO3 |
| Molecular Weight | 381.06 g/mol |
| Exact Mass | 378.94 |
| IUPAC Name | ethyl 2-[4-(2-aminoethyl)-2,6-dibromophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(CCN)cc1Br |
| InChI | InChI=1S/C12H15Br2NO3/c1-2-17-11(16)7-18-12-9(13)5-8(3-4-15)6-10(12)14/h5-6H,2-4,7,15H2,1H3 |
| InChIKey | ISHDSNGWGZGINP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.06 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |