C15H19BrN2O3 — CID 60906076
2-[4-(2-aminoethyl)-2-bromo-6-ethoxyphenoxy]-N-prop-2-ynylacetamide (PubChem CID 60906076) has the molecular formula C15H19BrN2O3 and a molecular weight of 355.23 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)-2-bromo-6-ethoxyphenoxy]-N-prop-2-ynylacetamide.
| Compound Name | 2-[4-(2-aminoethyl)-2-bromo-6-ethoxyphenoxy]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 60906076 |
| Molecular Formula | C15H19BrN2O3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 2-[4-(2-aminoethyl)-2-bromo-6-ethoxyphenoxy]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)COc1c(Br)cc(CCN)cc1OCC |
| InChI | InChI=1S/C15H19BrN2O3/c1-3-7-18-14(19)10-21-15-12(16)8-11(5-6-17)9-13(15)20-4-2/h1,8-9H,4-7,10,17H2,2H3,(H,18,19) |
| InChIKey | ROUIFPPUBSKOLT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|