C13H22N4O2S — CID 95003313
(2S)-4-methylsulfanyl-2-[[2-(propan-2-ylamino)pyrimidin-5-yl]methylamino]butanoic acid (PubChem CID 95003313) has the molecular formula C13H22N4O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-[[2-(propan-2-ylamino)pyrimidin-5-yl]methylamino]butanoic acid.
| Compound Name | (2S)-4-methylsulfanyl-2-[[2-(propan-2-ylamino)pyrimidin-5-yl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 95003313 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-[[2-(propan-2-ylamino)pyrimidin-5-yl]methylamino]butanoic acid |
| SMILES | CSCC[C@H](NCc1cnc(NC(C)C)nc1)C(=O)O |
| InChI | InChI=1S/C13H22N4O2S/c1-9(2)17-13-15-7-10(8-16-13)6-14-11(12(18)19)4-5-20-3/h7-9,11,14H,4-6H2,1-3H3,(H,18,19)(H,15,16,17)/t11-/m0/s1 |
| InChIKey | NFUWJFIEMAFRAT-NSHDSACASA-N |
| XLogP | 1.59 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |