C14H22N4O3S — CID 91671336
4-methylsulfanyl-2-[(2-morpholin-4-ylpyrimidin-5-yl)methylamino]butanoic acid (PubChem CID 91671336) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[(2-morpholin-4-ylpyrimidin-5-yl)methylamino]butanoic acid.
| Compound Name | 4-methylsulfanyl-2-[(2-morpholin-4-ylpyrimidin-5-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 91671336 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 4-methylsulfanyl-2-[(2-morpholin-4-ylpyrimidin-5-yl)methylamino]butanoic acid |
| SMILES | CSCCC(NCc1cnc(N2CCOCC2)nc1)C(=O)O |
| InChI | InChI=1S/C14H22N4O3S/c1-22-7-2-12(13(19)20)15-8-11-9-16-14(17-10-11)18-3-5-21-6-4-18/h9-10,12,15H,2-8H2,1H3,(H,19,20) |
| InChIKey | IWDPPEFJHWUYMB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |