C7H11ClN4 — CID 80769890
5-chloro-2-N-ethyl-4-N-methylpyrimidine-2,4-diamine (PubChem CID 80769890) has the molecular formula C7H11ClN4 and a molecular weight of 186.65 g/mol. Its IUPAC name is 5-chloro-2-N-ethyl-4-N-methylpyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-ethyl-4-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80769890 |
| Molecular Formula | C7H11ClN4 |
| Molecular Weight | 186.65 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 5-chloro-2-N-ethyl-4-N-methylpyrimidine-2,4-diamine |
| SMILES | CCNc1ncc(Cl)c(NC)n1 |
| InChI | InChI=1S/C7H11ClN4/c1-3-10-7-11-4-5(8)6(9-2)12-7/h4H,3H2,1-2H3,(H2,9,10,11,12) |
| InChIKey | MCNRHLJYMLCXCZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.65 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |