C10H17ClN4 — CID 80765829
4-N-butan-2-yl-5-chloro-2-N-ethylpyrimidine-2,4-diamine (PubChem CID 80765829) has the molecular formula C10H17ClN4 and a molecular weight of 228.73 g/mol. Its IUPAC name is 4-N-butan-2-yl-5-chloro-2-N-ethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-butan-2-yl-5-chloro-2-N-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80765829 |
| Molecular Formula | C10H17ClN4 |
| Molecular Weight | 228.73 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 4-N-butan-2-yl-5-chloro-2-N-ethylpyrimidine-2,4-diamine |
| SMILES | CCNc1ncc(Cl)c(NC(C)CC)n1 |
| InChI | InChI=1S/C10H17ClN4/c1-4-7(3)14-9-8(11)6-13-10(15-9)12-5-2/h6-7H,4-5H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | CVOUBEWYBFROQA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |