C8H7N5 — CID 57398215
3-(ethylamino)pyrazine-2,5-dicarbonitrile (PubChem CID 57398215) has the molecular formula C8H7N5 and a molecular weight of 173.18 g/mol. Its IUPAC name is 3-(ethylamino)pyrazine-2,5-dicarbonitrile.
| Compound Name | 3-(ethylamino)pyrazine-2,5-dicarbonitrile |
|---|---|
| PubChem CID | 57398215 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 3-(ethylamino)pyrazine-2,5-dicarbonitrile |
| SMILES | CCNc1nc(C#N)cnc1C#N |
| InChI | InChI=1S/C8H7N5/c1-2-11-8-7(4-10)12-5-6(3-9)13-8/h5H,2H2,1H3,(H,11,13) |
| InChIKey | BRLSDZJSMRBVRB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |