About 3-(ethylamino)pyrazine-2,5-dicarbonitrile
3-(ethylamino)pyrazine-2,5-dicarbonitrile (PubChem CID 57398215) has the molecular formula C8H7N5
and a molecular weight of 173.18 g/mol. Its IUPAC name is 3-(ethylamino)pyrazine-2,5-dicarbonitrile.
Molecular Properties
| Compound Name | 3-(ethylamino)pyrazine-2,5-dicarbonitrile |
| PubChem CID | 57398215 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 3-(ethylamino)pyrazine-2,5-dicarbonitrile |
| SMILES | CCNc1nc(C#N)cnc1C#N |
| InChI | InChI=1S/C8H7N5/c1-2-11-8-7(4-10)12-5-6(3-9)13-8/h5H,2H2,1H3,(H,11,13) |
| InChIKey | BRLSDZJSMRBVRB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(ethylamino)pyrazine-2,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylamino)pyrazine-2,5-dicarbonitrile?
The IUPAC name of 3-(ethylamino)pyrazine-2,5-dicarbonitrile (CID 57398215) is 3-(ethylamino)pyrazine-2,5-dicarbonitrile.
What is the SMILES notation for 3-(ethylamino)pyrazine-2,5-dicarbonitrile?
The canonical SMILES for 3-(ethylamino)pyrazine-2,5-dicarbonitrile is CCNc1nc(C#N)cnc1C#N.
What is the InChIKey of 3-(ethylamino)pyrazine-2,5-dicarbonitrile?
The InChIKey is BRLSDZJSMRBVRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5/c1-2-11-8-7(4-10)12-5-6(3-9)13-8/h5H,2H2,1H3,(H,11,13).
What are the key properties of 3-(ethylamino)pyrazine-2,5-dicarbonitrile?
3-(ethylamino)pyrazine-2,5-dicarbonitrile has a molecular weight of 173.18 g/mol, XLogP of 0.65, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylamino)pyrazine-2,5-dicarbonitrile is sourced from PubChem (CID 57398215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).