C10H13N3 — CID 102345603
2-(ethylamino)-4,5-dimethylpyridine-3-carbonitrile (PubChem CID 102345603) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-(ethylamino)-4,5-dimethylpyridine-3-carbonitrile.
| Compound Name | 2-(ethylamino)-4,5-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 102345603 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-(ethylamino)-4,5-dimethylpyridine-3-carbonitrile |
| SMILES | CCNc1ncc(C)c(C)c1C#N |
| InChI | InChI=1S/C10H13N3/c1-4-12-10-9(5-11)8(3)7(2)6-13-10/h6H,4H2,1-3H3,(H,12,13) |
| InChIKey | DDSXCYDTUGGJIL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |