C8H7BrN2 — CID 12919740
2-bromo-4,5-dimethylpyridine-3-carbonitrile (PubChem CID 12919740) has the molecular formula C8H7BrN2 and a molecular weight of 211.06 g/mol. Its IUPAC name is 2-bromo-4,5-dimethylpyridine-3-carbonitrile.
| Compound Name | 2-bromo-4,5-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 12919740 |
| Molecular Formula | C8H7BrN2 |
| Molecular Weight | 211.06 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | 2-bromo-4,5-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1cnc(Br)c(C#N)c1C |
| InChI | InChI=1S/C8H7BrN2/c1-5-4-11-8(9)7(3-10)6(5)2/h4H,1-2H3 |
| InChIKey | QRVGFTAEEAYPLI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.06 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|