About 3-(difluoromethyl)-4,5-dimethylpyridine-2-carbonitrile
3-(difluoromethyl)-4,5-dimethylpyridine-2-carbonitrile (PubChem CID 130101091) has the molecular formula C9H8F2N2
and a molecular weight of 182.17 g/mol. Its IUPAC name is 3-(difluoromethyl)-4,5-dimethylpyridine-2-carbonitrile.
Analyze 3-(difluoromethyl)-4,5-dimethylpyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-4,5-dimethylpyridine-2-carbonitrile?
The IUPAC name of 3-(difluoromethyl)-4,5-dimethylpyridine-2-carbonitrile (CID 130101091) is 3-(difluoromethyl)-4,5-dimethylpyridine-2-carbonitrile.
What is the SMILES notation for 3-(difluoromethyl)-4,5-dimethylpyridine-2-carbonitrile?
The canonical SMILES for 3-(difluoromethyl)-4,5-dimethylpyridine-2-carbonitrile is Cc1cnc(C#N)c(C(F)F)c1C.
What is the InChIKey of 3-(difluoromethyl)-4,5-dimethylpyridine-2-carbonitrile?
The InChIKey is ISALJVUALAHMDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2N2/c1-5-4-13-7(3-12)8(6(5)2)9(10)11/h4,9H,1-2H3.
What are the key properties of 3-(difluoromethyl)-4,5-dimethylpyridine-2-carbonitrile?
3-(difluoromethyl)-4,5-dimethylpyridine-2-carbonitrile has a molecular weight of 182.17 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-4,5-dimethylpyridine-2-carbonitrile is sourced from PubChem (CID 130101091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).