C9H5F5N2 — CID 119004811
3-(difluoromethyl)-5-methyl-4-(trifluoromethyl)pyridine-2-carbonitrile (PubChem CID 119004811) has the molecular formula C9H5F5N2 and a molecular weight of 236.14 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-methyl-4-(trifluoromethyl)pyridine-2-carbonitrile.
| Compound Name | 3-(difluoromethyl)-5-methyl-4-(trifluoromethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 119004811 |
| Molecular Formula | C9H5F5N2 |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-(difluoromethyl)-5-methyl-4-(trifluoromethyl)pyridine-2-carbonitrile |
| SMILES | Cc1cnc(C#N)c(C(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C9H5F5N2/c1-4-3-16-5(2-15)6(8(10)11)7(4)9(12,13)14/h3,8H,1H3 |
| InChIKey | VDRLRQYZYYBHBG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |