C10H7F5N2 — CID 118801473
2-[4-(difluoromethyl)-5-methyl-2-(trifluoromethyl)-3-pyridinyl]acetonitrile (PubChem CID 118801473) has the molecular formula C10H7F5N2 and a molecular weight of 250.17 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)-5-methyl-2-(trifluoromethyl)-3-pyridinyl]acetonitrile.
| Compound Name | 2-[4-(difluoromethyl)-5-methyl-2-(trifluoromethyl)-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118801473 |
| Molecular Formula | C10H7F5N2 |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 2-[4-(difluoromethyl)-5-methyl-2-(trifluoromethyl)-3-pyridinyl]acetonitrile |
| SMILES | Cc1cnc(C(F)(F)F)c(CC#N)c1C(F)F |
| InChI | InChI=1S/C10H7F5N2/c1-5-4-17-8(10(13,14)15)6(2-3-16)7(5)9(11)12/h4,9H,2H2,1H3 |
| InChIKey | AZFHPDYSUHOVLY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |