C8H9N3 — CID 90296601
2-amino-4,5-dimethylpyridine-3-carbonitrile (PubChem CID 90296601) has the molecular formula C8H9N3 and a molecular weight of 147.18 g/mol. Its IUPAC name is 2-amino-4,5-dimethylpyridine-3-carbonitrile.
| Compound Name | 2-amino-4,5-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 90296601 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 2-amino-4,5-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1cnc(N)c(C#N)c1C |
| InChI | InChI=1S/C8H9N3/c1-5-4-11-8(10)7(3-9)6(5)2/h4H,1-2H3,(H2,10,11) |
| InChIKey | MFHMDGUYIOFEIS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |