About 2-(tert-butylamino)-3,5-dimethylpyridine-4-carbonitrile
2-(tert-butylamino)-3,5-dimethylpyridine-4-carbonitrile (PubChem CID 138475559) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-(tert-butylamino)-3,5-dimethylpyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-(tert-butylamino)-3,5-dimethylpyridine-4-carbonitrile |
| PubChem CID | 138475559 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 2-(tert-butylamino)-3,5-dimethylpyridine-4-carbonitrile |
| SMILES | Cc1cnc(NC(C)(C)C)c(C)c1C#N |
| InChI | InChI=1S/C12H17N3/c1-8-7-14-11(15-12(3,4)5)9(2)10(8)6-13/h7H,1-5H3,(H,14,15) |
| InChIKey | GPLBPNJYYMYNMW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(tert-butylamino)-3,5-dimethylpyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tert-butylamino)-3,5-dimethylpyridine-4-carbonitrile?
The IUPAC name of 2-(tert-butylamino)-3,5-dimethylpyridine-4-carbonitrile (CID 138475559) is 2-(tert-butylamino)-3,5-dimethylpyridine-4-carbonitrile.
What is the SMILES notation for 2-(tert-butylamino)-3,5-dimethylpyridine-4-carbonitrile?
The canonical SMILES for 2-(tert-butylamino)-3,5-dimethylpyridine-4-carbonitrile is Cc1cnc(NC(C)(C)C)c(C)c1C#N.
What is the InChIKey of 2-(tert-butylamino)-3,5-dimethylpyridine-4-carbonitrile?
The InChIKey is GPLBPNJYYMYNMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3/c1-8-7-14-11(15-12(3,4)5)9(2)10(8)6-13/h7H,1-5H3,(H,14,15).
What are the key properties of 2-(tert-butylamino)-3,5-dimethylpyridine-4-carbonitrile?
2-(tert-butylamino)-3,5-dimethylpyridine-4-carbonitrile has a molecular weight of 203.29 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butylamino)-3,5-dimethylpyridine-4-carbonitrile is sourced from PubChem (CID 138475559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).