C14H13FN4O — CID 107662559
3-[2-(ethylamino)-5-fluoropyrimidin-4-yl]oxy-4-methylbenzonitrile (PubChem CID 107662559) has the molecular formula C14H13FN4O and a molecular weight of 272.28 g/mol. Its IUPAC name is 3-[2-(ethylamino)-5-fluoropyrimidin-4-yl]oxy-4-methylbenzonitrile.
| Compound Name | 3-[2-(ethylamino)-5-fluoropyrimidin-4-yl]oxy-4-methylbenzonitrile |
|---|---|
| PubChem CID | 107662559 |
| Molecular Formula | C14H13FN4O |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 3-[2-(ethylamino)-5-fluoropyrimidin-4-yl]oxy-4-methylbenzonitrile |
| SMILES | CCNc1ncc(F)c(Oc2cc(C#N)ccc2C)n1 |
| InChI | InChI=1S/C14H13FN4O/c1-3-17-14-18-8-11(15)13(19-14)20-12-6-10(7-16)5-4-9(12)2/h4-6,8H,3H2,1-2H3,(H,17,18,19) |
| InChIKey | UCCFMNNDROSQDM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |