C15H15FN4O — CID 107662517
3-[5-fluoro-2-(propylamino)pyrimidin-4-yl]oxy-4-methylbenzonitrile (PubChem CID 107662517) has the molecular formula C15H15FN4O and a molecular weight of 286.31 g/mol. Its IUPAC name is 3-[5-fluoro-2-(propylamino)pyrimidin-4-yl]oxy-4-methylbenzonitrile.
| Compound Name | 3-[5-fluoro-2-(propylamino)pyrimidin-4-yl]oxy-4-methylbenzonitrile |
|---|---|
| PubChem CID | 107662517 |
| Molecular Formula | C15H15FN4O |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-[5-fluoro-2-(propylamino)pyrimidin-4-yl]oxy-4-methylbenzonitrile |
| SMILES | CCCNc1ncc(F)c(Oc2cc(C#N)ccc2C)n1 |
| InChI | InChI=1S/C15H15FN4O/c1-3-6-18-15-19-9-12(16)14(20-15)21-13-7-11(8-17)5-4-10(13)2/h4-5,7,9H,3,6H2,1-2H3,(H,18,19,20) |
| InChIKey | DRRFFQTVDXRHID-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |