C8H10N4 — CID 116975578
2-[(5-ethylpyrimidin-2-yl)amino]acetonitrile (PubChem CID 116975578) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 2-[(5-ethylpyrimidin-2-yl)amino]acetonitrile.
| Compound Name | 2-[(5-ethylpyrimidin-2-yl)amino]acetonitrile |
|---|---|
| PubChem CID | 116975578 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2-[(5-ethylpyrimidin-2-yl)amino]acetonitrile |
| SMILES | CCc1cnc(NCC#N)nc1 |
| InChI | InChI=1S/C8H10N4/c1-2-7-5-11-8(12-6-7)10-4-3-9/h5-6H,2,4H2,1H3,(H,10,11,12) |
| InChIKey | UDHFQTRGOLBKKT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|