C12H9FN4 — CID 116975593
2-[[5-(4-fluorophenyl)pyrimidin-2-yl]amino]acetonitrile (PubChem CID 116975593) has the molecular formula C12H9FN4 and a molecular weight of 228.23 g/mol. Its IUPAC name is 2-[[5-(4-fluorophenyl)pyrimidin-2-yl]amino]acetonitrile.
| Compound Name | 2-[[5-(4-fluorophenyl)pyrimidin-2-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 116975593 |
| Molecular Formula | C12H9FN4 |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-[[5-(4-fluorophenyl)pyrimidin-2-yl]amino]acetonitrile |
| SMILES | N#CCNc1ncc(-c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C12H9FN4/c13-11-3-1-9(2-4-11)10-7-16-12(17-8-10)15-6-5-14/h1-4,7-8H,6H2,(H,15,16,17) |
| InChIKey | ZFDCLVQYEJSQOU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|