C12H8BrFN4 — CID 116975651
2-[[5-(5-bromo-2-fluorophenyl)pyrimidin-2-yl]amino]acetonitrile (PubChem CID 116975651) has the molecular formula C12H8BrFN4 and a molecular weight of 307.13 g/mol. Its IUPAC name is 2-[[5-(5-bromo-2-fluorophenyl)pyrimidin-2-yl]amino]acetonitrile.
| Compound Name | 2-[[5-(5-bromo-2-fluorophenyl)pyrimidin-2-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 116975651 |
| Molecular Formula | C12H8BrFN4 |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 2-[[5-(5-bromo-2-fluorophenyl)pyrimidin-2-yl]amino]acetonitrile |
| SMILES | N#CCNc1ncc(-c2cc(Br)ccc2F)cn1 |
| InChI | InChI=1S/C12H8BrFN4/c13-9-1-2-11(14)10(5-9)8-6-17-12(18-7-8)16-4-3-15/h1-2,5-7H,4H2,(H,16,17,18) |
| InChIKey | VZONUWJUAVOKNG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|