C11H9BrFN3 — CID 116977034
5-(5-bromo-2-fluorophenyl)-N-methylpyrimidin-2-amine (PubChem CID 116977034) has the molecular formula C11H9BrFN3 and a molecular weight of 282.12 g/mol. Its IUPAC name is 5-(5-bromo-2-fluorophenyl)-N-methylpyrimidin-2-amine.
| Compound Name | 5-(5-bromo-2-fluorophenyl)-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 116977034 |
| Molecular Formula | C11H9BrFN3 |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 5-(5-bromo-2-fluorophenyl)-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(-c2cc(Br)ccc2F)cn1 |
| InChI | InChI=1S/C11H9BrFN3/c1-14-11-15-5-7(6-16-11)9-4-8(12)2-3-10(9)13/h2-6H,1H3,(H,14,15,16) |
| InChIKey | YZPCMMOJRKOTJH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |