C11H5BrCl2FN — CID 84604363
4-(5-bromo-2-fluorophenyl)-2,6-dichloropyridine (PubChem CID 84604363) has the molecular formula C11H5BrCl2FN and a molecular weight of 320.98 g/mol. Its IUPAC name is 4-(5-bromo-2-fluorophenyl)-2,6-dichloropyridine.
| Compound Name | 4-(5-bromo-2-fluorophenyl)-2,6-dichloropyridine |
|---|---|
| PubChem CID | 84604363 |
| Molecular Formula | C11H5BrCl2FN |
| Molecular Weight | 320.98 g/mol |
| Exact Mass | 318.90 |
| IUPAC Name | 4-(5-bromo-2-fluorophenyl)-2,6-dichloropyridine |
| SMILES | Fc1ccc(Br)cc1-c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C11H5BrCl2FN/c12-7-1-2-9(15)8(5-7)6-3-10(13)16-11(14)4-6/h1-5H |
| InChIKey | HEZZOMUYDAJXBJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.98 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|