C8H13IN2 — CID 143798194
2,5-diethylpyrimidine;hydroiodide (PubChem CID 143798194) has the molecular formula C8H13IN2 and a molecular weight of 264.11 g/mol. Its IUPAC name is 2,5-diethylpyrimidine;hydroiodide.
| Compound Name | 2,5-diethylpyrimidine;hydroiodide |
|---|---|
| PubChem CID | 143798194 |
| Molecular Formula | C8H13IN2 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 2,5-diethylpyrimidine;hydroiodide |
| SMILES | CCc1cnc(CC)nc1.I |
| InChI | InChI=1S/C8H12N2.HI/c1-3-7-5-9-8(4-2)10-6-7;/h5-6H,3-4H2,1-2H3;1H |
| InChIKey | BPKIHKQMTMPZFP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|