C10H7N5 — CID 156784005
4-(1,3,5-triazin-2-ylamino)benzonitrile (PubChem CID 156784005) has the molecular formula C10H7N5 and a molecular weight of 197.20 g/mol. Its IUPAC name is 4-(1,3,5-triazin-2-ylamino)benzonitrile.
| Compound Name | 4-(1,3,5-triazin-2-ylamino)benzonitrile |
|---|---|
| PubChem CID | 156784005 |
| Molecular Formula | C10H7N5 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 4-(1,3,5-triazin-2-ylamino)benzonitrile |
| SMILES | N#Cc1ccc(Nc2ncncn2)cc1 |
| InChI | InChI=1S/C10H7N5/c11-5-8-1-3-9(4-2-8)15-10-13-6-12-7-14-10/h1-4,6-7H,(H,12,13,14,15) |
| InChIKey | WFYFLEGSVWCJPX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |