C12H8N4O — CID 175239360
4-[(4-formylpyrimidin-2-yl)amino]benzonitrile (PubChem CID 175239360) has the molecular formula C12H8N4O and a molecular weight of 224.22 g/mol. Its IUPAC name is 4-[(4-formylpyrimidin-2-yl)amino]benzonitrile.
| Compound Name | 4-[(4-formylpyrimidin-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 175239360 |
| Molecular Formula | C12H8N4O |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 4-[(4-formylpyrimidin-2-yl)amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nccc(C=O)n2)cc1 |
| InChI | InChI=1S/C12H8N4O/c13-7-9-1-3-10(4-2-9)15-12-14-6-5-11(8-17)16-12/h1-6,8H,(H,14,15,16) |
| InChIKey | MKLMYPILZQSGBR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|