C22H18N6 — CID 90681301
4-[[2-(4-cyanoanilino)pyrimidin-4-yl]-(cyclopropylamino)methyl]benzonitrile (PubChem CID 90681301) has the molecular formula C22H18N6 and a molecular weight of 366.43 g/mol. Its IUPAC name is 4-[[2-(4-cyanoanilino)pyrimidin-4-yl]-(cyclopropylamino)methyl]benzonitrile.
| Compound Name | 4-[[2-(4-cyanoanilino)pyrimidin-4-yl]-(cyclopropylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 90681301 |
| Molecular Formula | C22H18N6 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-[[2-(4-cyanoanilino)pyrimidin-4-yl]-(cyclopropylamino)methyl]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nccc(C(NC3CC3)c3ccc(C#N)cc3)n2)cc1 |
| InChI | InChI=1S/C22H18N6/c23-13-15-1-5-17(6-2-15)21(26-18-9-10-18)20-11-12-25-22(28-20)27-19-7-3-16(14-24)4-8-19/h1-8,11-12,18,21,26H,9-10H2,(H,25,27,28) |
| InChIKey | VYWLYCOJZHRGHV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |