C25H16ClN5O — CID 162669189
4-[3-chloro-4-[(R)-[2-(4-cyanoanilino)pyrimidin-4-yl]-hydroxymethyl]phenyl]benzonitrile (PubChem CID 162669189) has the molecular formula C25H16ClN5O and a molecular weight of 437.89 g/mol. Its IUPAC name is 4-[3-chloro-4-[(R)-[2-(4-cyanoanilino)pyrimidin-4-yl]-hydroxymethyl]phenyl]benzonitrile.
| Compound Name | 4-[3-chloro-4-[(R)-[2-(4-cyanoanilino)pyrimidin-4-yl]-hydroxymethyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 162669189 |
| Molecular Formula | C25H16ClN5O |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 4-[3-chloro-4-[(R)-[2-(4-cyanoanilino)pyrimidin-4-yl]-hydroxymethyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nccc([C@H](O)c3ccc(-c4ccc(C#N)cc4)cc3Cl)n2)cc1 |
| InChI | InChI=1S/C25H16ClN5O/c26-22-13-19(18-5-1-16(14-27)2-6-18)7-10-21(22)24(32)23-11-12-29-25(31-23)30-20-8-3-17(15-28)4-9-20/h1-13,24,32H,(H,29,30,31)/t24-/m1/s1 |
| InChIKey | LRGUYOVPBIAHKP-XMMPIXPASA-N |
| XLogP | 5.37 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |