C21H18ClN5 — CID 90681303
4-[[4-[(2-chlorophenyl)-(cyclopropylamino)methyl]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 90681303) has the molecular formula C21H18ClN5 and a molecular weight of 375.86 g/mol. Its IUPAC name is 4-[[4-[(2-chlorophenyl)-(cyclopropylamino)methyl]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[(2-chlorophenyl)-(cyclopropylamino)methyl]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 90681303 |
| Molecular Formula | C21H18ClN5 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-[[4-[(2-chlorophenyl)-(cyclopropylamino)methyl]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nccc(C(NC3CC3)c3ccccc3Cl)n2)cc1 |
| InChI | InChI=1S/C21H18ClN5/c22-18-4-2-1-3-17(18)20(25-15-9-10-15)19-11-12-24-21(27-19)26-16-7-5-14(13-23)6-8-16/h1-8,11-12,15,20,25H,9-10H2,(H,24,26,27) |
| InChIKey | DCHBQOBJLLOKMU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |