C20H11FN6 — CID 155924358
4-[cyano-[2-(4-cyanoanilino)pyrimidin-4-yl]methyl]-3-fluorobenzonitrile (PubChem CID 155924358) has the molecular formula C20H11FN6 and a molecular weight of 354.35 g/mol. Its IUPAC name is 4-[cyano-[2-(4-cyanoanilino)pyrimidin-4-yl]methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[cyano-[2-(4-cyanoanilino)pyrimidin-4-yl]methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 155924358 |
| Molecular Formula | C20H11FN6 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 4-[cyano-[2-(4-cyanoanilino)pyrimidin-4-yl]methyl]-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(Nc2nccc(C(C#N)c3ccc(C#N)cc3F)n2)cc1 |
| InChI | InChI=1S/C20H11FN6/c21-18-9-14(11-23)3-6-16(18)17(12-24)19-7-8-25-20(27-19)26-15-4-1-13(10-22)2-5-15/h1-9,17H,(H,25,26,27) |
| InChIKey | DDRXBNYUYCCCQM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |