C19H15N5O2 — CID 91462523
4-[[4-[(3-methoxyphenyl)-nitrosomethyl]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 91462523) has the molecular formula C19H15N5O2 and a molecular weight of 345.36 g/mol. Its IUPAC name is 4-[[4-[(3-methoxyphenyl)-nitrosomethyl]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[(3-methoxyphenyl)-nitrosomethyl]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 91462523 |
| Molecular Formula | C19H15N5O2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 4-[[4-[(3-methoxyphenyl)-nitrosomethyl]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | COc1cccc(C(N=O)c2ccnc(Nc3ccc(C#N)cc3)n2)c1 |
| InChI | InChI=1S/C19H15N5O2/c1-26-16-4-2-3-14(11-16)18(24-25)17-9-10-21-19(23-17)22-15-7-5-13(12-20)6-8-15/h2-11,18H,1H3,(H,21,22,23) |
| InChIKey | CJPXNZGATSUEPE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |