C20H17N5O3 — CID 109318102
2-(4-cyanoanilino)-N-(3,4-dimethoxyphenyl)pyrimidine-4-carboxamide (PubChem CID 109318102) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-N-(3,4-dimethoxyphenyl)pyrimidine-4-carboxamide.
| Compound Name | 2-(4-cyanoanilino)-N-(3,4-dimethoxyphenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109318102 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-(4-cyanoanilino)-N-(3,4-dimethoxyphenyl)pyrimidine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccnc(Nc3ccc(C#N)cc3)n2)cc1OC |
| InChI | InChI=1S/C20H17N5O3/c1-27-17-8-7-15(11-18(17)28-2)23-19(26)16-9-10-22-20(25-16)24-14-5-3-13(12-21)4-6-14/h3-11H,1-2H3,(H,23,26)(H,22,24,25) |
| InChIKey | FQOSLNJULRHRIB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |