C18H11Cl2N5O — CID 109318737
N-(4-cyanophenyl)-2-(3,5-dichloroanilino)pyrimidine-4-carboxamide (PubChem CID 109318737) has the molecular formula C18H11Cl2N5O and a molecular weight of 384.23 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-(3,5-dichloroanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(4-cyanophenyl)-2-(3,5-dichloroanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109318737 |
| Molecular Formula | C18H11Cl2N5O |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | N-(4-cyanophenyl)-2-(3,5-dichloroanilino)pyrimidine-4-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2ccnc(Nc3cc(Cl)cc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C18H11Cl2N5O/c19-12-7-13(20)9-15(8-12)24-18-22-6-5-16(25-18)17(26)23-14-3-1-11(10-21)2-4-14/h1-9H,(H,23,26)(H,22,24,25) |
| InChIKey | YAAYBOFCAMCYJT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |