C19H14ClN5O — CID 109306028
2-[(4-chlorophenyl)methylamino]-N-(4-cyanophenyl)pyrimidine-4-carboxamide (PubChem CID 109306028) has the molecular formula C19H14ClN5O and a molecular weight of 363.81 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylamino]-N-(4-cyanophenyl)pyrimidine-4-carboxamide.
| Compound Name | 2-[(4-chlorophenyl)methylamino]-N-(4-cyanophenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109306028 |
| Molecular Formula | C19H14ClN5O |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-[(4-chlorophenyl)methylamino]-N-(4-cyanophenyl)pyrimidine-4-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2ccnc(NCc3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C19H14ClN5O/c20-15-5-1-14(2-6-15)12-23-19-22-10-9-17(25-19)18(26)24-16-7-3-13(11-21)4-8-16/h1-10H,12H2,(H,24,26)(H,22,23,25) |
| InChIKey | YTDQOLCRYUHARD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |