C19H15N5O2 — CID 109317597
2-(3-cyanoanilino)-N-(2-methoxyphenyl)pyrimidine-4-carboxamide (PubChem CID 109317597) has the molecular formula C19H15N5O2 and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-(3-cyanoanilino)-N-(2-methoxyphenyl)pyrimidine-4-carboxamide.
| Compound Name | 2-(3-cyanoanilino)-N-(2-methoxyphenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109317597 |
| Molecular Formula | C19H15N5O2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-(3-cyanoanilino)-N-(2-methoxyphenyl)pyrimidine-4-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1ccnc(Nc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C19H15N5O2/c1-26-17-8-3-2-7-15(17)23-18(25)16-9-10-21-19(24-16)22-14-6-4-5-13(11-14)12-20/h2-11H,1H3,(H,23,25)(H,21,22,24) |
| InChIKey | CGNFRMABQXWTGU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |