C9H8N6 — CID 72714702
4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]benzonitrile (PubChem CID 72714702) has the molecular formula C9H8N6 and a molecular weight of 200.21 g/mol. Its IUPAC name is 4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]benzonitrile.
| Compound Name | 4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 72714702 |
| Molecular Formula | C9H8N6 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2n[nH]c(N)n2)cc1 |
| InChI | InChI=1S/C9H8N6/c10-5-6-1-3-7(4-2-6)12-9-13-8(11)14-15-9/h1-4H,(H4,11,12,13,14,15) |
| InChIKey | HEPNLFKTJOUWPV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |